C15H21FO — CID 176856906
1-fluoro-4-[(1R,2S)-2-propan-2-ylcyclohexyl]oxybenzene (PubChem CID 176856906) has the molecular formula C15H21FO and a molecular weight of 236.33 g/mol. Its IUPAC name is 1-fluoro-4-[(1R,2S)-2-propan-2-ylcyclohexyl]oxybenzene.
| Compound Name | 1-fluoro-4-[(1R,2S)-2-propan-2-ylcyclohexyl]oxybenzene |
|---|---|
| PubChem CID | 176856906 |
| Molecular Formula | C15H21FO |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-fluoro-4-[(1R,2S)-2-propan-2-ylcyclohexyl]oxybenzene |
| SMILES | CC(C)[C@@H]1CCCC[C@H]1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FO/c1-11(2)14-5-3-4-6-15(14)17-13-9-7-12(16)8-10-13/h7-11,14-15H,3-6H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | OSMPJNNPKNZPKR-LSDHHAIUSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |