C20H23F2NO2 — CID 124744406
cis-(1S,2R)-2-[4-[[(1S)-1-(3,5-difluorophenyl)ethyl]amino]phenoxy]cyclohexan-1-ol (PubChem CID 124744406) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is cis-(1S,2R)-2-[4-[[(1S)-1-(3,5-difluorophenyl)ethyl]amino]phenoxy]cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-[4-[[(1S)-1-(3,5-difluorophenyl)ethyl]amino]phenoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 124744406 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | cis-(1S,2R)-2-[4-[[(1S)-1-(3,5-difluorophenyl)ethyl]amino]phenoxy]cyclohexan-1-ol |
| SMILES | C[C@H](Nc1ccc(O[C@@H]2CCCC[C@@H]2O)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H23F2NO2/c1-13(14-10-15(21)12-16(22)11-14)23-17-6-8-18(9-7-17)25-20-5-3-2-4-19(20)24/h6-13,19-20,23-24H,2-5H2,1H3/t13-,19-,20+/m0/s1 |
| InChIKey | ZXSVJCXXEVBMIH-QTJFZDIUSA-N |
| XLogP | 4.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|