C15H21FO3 — CID 107720122
2-[3-fluoro-4-[(1R)-1-hydroxyethyl]phenoxy]cycloheptan-1-ol (PubChem CID 107720122) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[3-fluoro-4-[(1R)-1-hydroxyethyl]phenoxy]cycloheptan-1-ol.
| Compound Name | 2-[3-fluoro-4-[(1R)-1-hydroxyethyl]phenoxy]cycloheptan-1-ol |
|---|---|
| PubChem CID | 107720122 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[3-fluoro-4-[(1R)-1-hydroxyethyl]phenoxy]cycloheptan-1-ol |
| SMILES | C[C@@H](O)c1ccc(OC2CCCCCC2O)cc1F |
| InChI | InChI=1S/C15H21FO3/c1-10(17)12-8-7-11(9-13(12)16)19-15-6-4-2-3-5-14(15)18/h7-10,14-15,17-18H,2-6H2,1H3/t10-,14?,15?/m1/s1 |
| InChIKey | LQWWZRXGHQQYDC-SFNBMPIDSA-N |
| XLogP | 2.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |