C22H28NO7+ — CID 140620672
[(3S,7S,8S,9S)-7,8-bis(4-methoxyphenoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium (PubChem CID 140620672) has the molecular formula C22H28NO7+ and a molecular weight of 418.47 g/mol. Its IUPAC name is [(3S,7S,8S,9S)-7,8-bis(4-methoxyphenoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium.
| Compound Name | [(3S,7S,8S,9S)-7,8-bis(4-methoxyphenoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
|---|---|
| PubChem CID | 140620672 |
| Molecular Formula | C22H28NO7+ |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(3S,7S,8S,9S)-7,8-bis(4-methoxyphenoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
| SMILES | COc1ccc(O[C@H]2[C@H](C)OC(=O)[C@@H]([NH3+])COC[C@@H]2Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H27NO7/c1-14-21(30-18-10-6-16(26-3)7-11-18)20(13-27-12-19(23)22(24)28-14)29-17-8-4-15(25-2)5-9-17/h4-11,14,19-21H,12-13,23H2,1-3H3/p+1/t14-,19-,20-,21-/m0/s1 |
| InChIKey | HBLIEDNXSBTAHU-CXTHYWKRSA-O |
| XLogP | 1.47 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |