C23H28BrN3O3S — CID 100846232
1-[5-bromo-6-[(3S)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]propan-1-one (PubChem CID 100846232) has the molecular formula C23H28BrN3O3S and a molecular weight of 506.47 g/mol. Its IUPAC name is 1-[5-bromo-6-[(3S)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]propan-1-one.
| Compound Name | 1-[5-bromo-6-[(3S)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 100846232 |
| Molecular Formula | C23H28BrN3O3S |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 1-[5-bromo-6-[(3S)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCc2cc(Br)c(S(=O)(=O)N3CCN(c4ccc(C)cc4)[C@@H](C)C3)cc21 |
| InChI | InChI=1S/C23H28BrN3O3S/c1-4-23(28)27-10-9-18-13-20(24)22(14-21(18)27)31(29,30)25-11-12-26(17(3)15-25)19-7-5-16(2)6-8-19/h5-8,13-14,17H,4,9-12,15H2,1-3H3/t17-/m0/s1 |
| InChIKey | LDKDIUBUDGFNNA-KRWDZBQOSA-N |
| XLogP | 3.96 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|