C25H31N3O3S — CID 20853279
cyclobutyl-[5-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]methanone (PubChem CID 20853279) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is cyclobutyl-[5-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]methanone.
| Compound Name | cyclobutyl-[5-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 20853279 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | cyclobutyl-[5-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonyl-2,3-dihydroindol-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(S(=O)(=O)c3ccc4c(c3)CCN4C(=O)C3CCC3)CC2C)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-18-6-8-22(9-7-18)27-15-14-26(17-19(27)2)32(30,31)23-10-11-24-21(16-23)12-13-28(24)25(29)20-4-3-5-20/h6-11,16,19-20H,3-5,12-15,17H2,1-2H3 |
| InChIKey | GXGOZFQOEGJYCP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|