C35H24Cl2N2O5 — CID 100847641
[4-[(2'R,3S,3'S,10'bS)-2'-(2,4-dichlorobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate (PubChem CID 100847641) has the molecular formula C35H24Cl2N2O5 and a molecular weight of 623.49 g/mol. Its IUPAC name is [4-[(2'R,3S,3'S,10'bS)-2'-(2,4-dichlorobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate.
| Compound Name | [4-[(2'R,3S,3'S,10'bS)-2'-(2,4-dichlorobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 100847641 |
| Molecular Formula | C35H24Cl2N2O5 |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | [4-[(2'R,3S,3'S,10'bS)-2'-(2,4-dichlorobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@H](C(=O)c3ccc(Cl)cc3Cl)[C@@]3(C(=O)Nc4ccccc43)[C@@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C35H24Cl2N2O5/c1-19(40)44-23-13-10-21(11-14-23)31(41)30-29(32(42)25-15-12-22(36)18-27(25)37)35(26-8-4-5-9-28(26)38-34(35)43)33-24-7-3-2-6-20(24)16-17-39(30)33/h2-18,29-30,33H,1H3,(H,38,43)/t29-,30+,33+,35-/m1/s1 |
| InChIKey | GVRBTXXOBMXJLS-CPJIJYJCSA-N |
| XLogP | 6.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|