C35H25N3O7 — CID 44663792
[4-[2'-(4-nitrobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate (PubChem CID 44663792) has the molecular formula C35H25N3O7 and a molecular weight of 599.60 g/mol. Its IUPAC name is [4-[2'-(4-nitrobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate.
| Compound Name | [4-[2'-(4-nitrobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 44663792 |
| Molecular Formula | C35H25N3O7 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | [4-[2'-(4-nitrobenzoyl)-2-oxospiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)C2C(C(=O)c3ccc([N+](=O)[O-])cc3)C3(C(=O)Nc4ccccc43)C3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C35H25N3O7/c1-20(39)45-25-16-12-23(13-17-25)32(41)30-29(31(40)22-10-14-24(15-11-22)38(43)44)35(27-8-4-5-9-28(27)36-34(35)42)33-26-7-3-2-6-21(26)18-19-37(30)33/h2-19,29-30,33H,1H3,(H,36,42) |
| InChIKey | KHCJVOYEERZCRS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|