C33H22ClN3O5 — CID 124780031
(2'R,3R,3'S,10'bS)-3'-(4-chlorobenzoyl)-2'-(4-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 124780031) has the molecular formula C33H22ClN3O5 and a molecular weight of 576.01 g/mol. Its IUPAC name is (2'R,3R,3'S,10'bS)-3'-(4-chlorobenzoyl)-2'-(4-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3R,3'S,10'bS)-3'-(4-chlorobenzoyl)-2'-(4-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 124780031 |
| Molecular Formula | C33H22ClN3O5 |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | (2'R,3R,3'S,10'bS)-3'-(4-chlorobenzoyl)-2'-(4-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1[C@H](C(=O)c2ccc([N+](=O)[O-])cc2)[C@]2(C(=O)Nc3ccccc32)[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C33H22ClN3O5/c34-22-13-9-21(10-14-22)30(39)28-27(29(38)20-11-15-23(16-12-20)37(41)42)33(25-7-3-4-8-26(25)35-32(33)40)31-24-6-2-1-5-19(24)17-18-36(28)31/h1-18,27-28,31H,(H,35,40)/t27-,28+,31+,33+/m1/s1 |
| InChIKey | WIXOSKXCILXJHS-UPOHCCNUSA-N |
| XLogP | 6.23 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|