C34H25N3O5 — CID 98222213
[4-[(2'R,3R,3'S,10'bR)-2-oxo-2'-(pyridine-3-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate (PubChem CID 98222213) has the molecular formula C34H25N3O5 and a molecular weight of 555.59 g/mol. Its IUPAC name is [4-[(2'R,3R,3'S,10'bR)-2-oxo-2'-(pyridine-3-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate.
| Compound Name | [4-[(2'R,3R,3'S,10'bR)-2-oxo-2'-(pyridine-3-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 98222213 |
| Molecular Formula | C34H25N3O5 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | [4-[(2'R,3R,3'S,10'bR)-2-oxo-2'-(pyridine-3-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@H](C(=O)c3cccnc3)[C@]3(C(=O)Nc4ccccc43)[C@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C34H25N3O5/c1-20(38)42-24-14-12-22(13-15-24)31(40)29-28(30(39)23-8-6-17-35-19-23)34(26-10-4-5-11-27(26)36-33(34)41)32-25-9-3-2-7-21(25)16-18-37(29)32/h2-19,28-29,32H,1H3,(H,36,41)/t28-,29+,32-,34+/m1/s1 |
| InChIKey | INYHJVWLZRVBPT-FVYOSNSJSA-N |
| XLogP | 4.99 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|