C32H29N5O4 — CID 100848954
N-[4-[(1R,3S,3aS,6aR)-5'-ethyl-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl]acetamide (PubChem CID 100848954) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-[4-[(1R,3S,3aS,6aR)-5'-ethyl-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl]acetamide.
| Compound Name | N-[4-[(1R,3S,3aS,6aR)-5'-ethyl-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100848954 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | N-[4-[(1R,3S,3aS,6aR)-5'-ethyl-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl]acetamide |
| SMILES | CCc1ccc2c(c1)[C@]1(N[C@H](Cc3c[nH]c4ccccc34)[C@@H]3C(=O)N(c4ccc(NC(C)=O)cc4)C(=O)[C@@H]31)C(=O)N2 |
| InChI | InChI=1S/C32H29N5O4/c1-3-18-8-13-25-23(14-18)32(31(41)35-25)28-27(26(36-32)15-19-16-33-24-7-5-4-6-22(19)24)29(39)37(30(28)40)21-11-9-20(10-12-21)34-17(2)38/h4-14,16,26-28,33,36H,3,15H2,1-2H3,(H,34,38)(H,35,41)/t26-,27+,28-,32-/m1/s1 |
| InChIKey | XAGUWEUGOILZHF-FFAHVWSXSA-N |
| XLogP | 3.86 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|