C28H20F2N4O3 — CID 29056856
(1R,3S,3aR,6aS)-5'-fluoro-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 29056856) has the molecular formula C28H20F2N4O3 and a molecular weight of 498.49 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5'-fluoro-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5'-fluoro-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 29056856 |
| Molecular Formula | C28H20F2N4O3 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (1R,3S,3aR,6aS)-5'-fluoro-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1[C@H]2[C@@H](C(=O)N1c1ccc(F)cc1)[C@@]1(N[C@@H]2Cc2c[nH]c3ccccc23)C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C28H20F2N4O3/c29-15-5-8-17(9-6-15)34-25(35)23-22(11-14-13-31-20-4-2-1-3-18(14)20)33-28(24(23)26(34)36)19-12-16(30)7-10-21(19)32-27(28)37/h1-10,12-13,22-24,31,33H,11H2,(H,32,37)/t22-,23-,24+,28-/m1/s1 |
| InChIKey | BALSSSKUZWURQG-QUIZSENMSA-N |
| XLogP | 3.61 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|