C25H23FN4O4 — CID 4970399
5'-fluoro-1-(1H-indol-3-ylmethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4970399) has the molecular formula C25H23FN4O4 and a molecular weight of 462.48 g/mol. Its IUPAC name is 5'-fluoro-1-(1H-indol-3-ylmethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5'-fluoro-1-(1H-indol-3-ylmethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4970399 |
| Molecular Formula | C25H23FN4O4 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 5'-fluoro-1-(1H-indol-3-ylmethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)C2C(Cc3c[nH]c4ccccc34)NC3(C(=O)Nc4ccc(F)cc43)C2C1=O |
| InChI | InChI=1S/C25H23FN4O4/c1-34-9-8-30-22(31)20-19(10-13-12-27-17-5-3-2-4-15(13)17)29-25(21(20)23(30)32)16-11-14(26)6-7-18(16)28-24(25)33/h2-7,11-12,19-21,27,29H,8-10H2,1H3,(H,28,33) |
| InChIKey | GEKOQHMRFTZDPZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|