C32H29ClN4O5 — CID 44663882
5'-chloro-5-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 44663882) has the molecular formula C32H29ClN4O5 and a molecular weight of 585.06 g/mol. Its IUPAC name is 5'-chloro-5-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5'-chloro-5-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 44663882 |
| Molecular Formula | C32H29ClN4O5 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 5'-chloro-5-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1H-indol-3-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COc1ccc(CCN2C(=O)C3C(Cc4c[nH]c5ccccc45)NC4(C(=O)Nc5ccc(Cl)cc54)C3C2=O)cc1OC |
| InChI | InChI=1S/C32H29ClN4O5/c1-41-25-10-7-17(13-26(25)42-2)11-12-37-29(38)27-24(14-18-16-34-22-6-4-3-5-20(18)22)36-32(28(27)30(37)39)21-15-19(33)8-9-23(21)35-31(32)40/h3-10,13,15-16,24,27-28,34,36H,11-12,14H2,1-2H3,(H,35,40) |
| InChIKey | QBBOEJJIFLLBIH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|