C30H28ClN3O7 — CID 98451831
(1S,3S,3aR,6aR)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 98451831) has the molecular formula C30H28ClN3O7 and a molecular weight of 578.02 g/mol. Its IUPAC name is (1S,3S,3aR,6aR)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aR)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98451831 |
| Molecular Formula | C30H28ClN3O7 |
| Molecular Weight | 578.02 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | (1S,3S,3aR,6aR)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COc1ccc(CCN2C(=O)[C@H]3[C@H](Cc4ccc(O)c(O)c4)N[C@@]4(C(=O)Nc5ccc(Cl)cc54)[C@@H]3C2=O)cc1OC |
| InChI | InChI=1S/C30H28ClN3O7/c1-40-23-8-4-15(13-24(23)41-2)9-10-34-27(37)25-20(11-16-3-7-21(35)22(36)12-16)33-30(26(25)28(34)38)18-14-17(31)5-6-19(18)32-29(30)39/h3-8,12-14,20,25-26,33,35-36H,9-11H2,1-2H3,(H,32,39)/t20-,25-,26-,30+/m0/s1 |
| InChIKey | OHEMAVIQDGBOJN-BTANPKBMSA-N |
| XLogP | 2.97 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|