C24H24ClN3O5 — CID 4898760
5-butan-2-yl-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4898760) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is 5-butan-2-yl-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5-butan-2-yl-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4898760 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 5-butan-2-yl-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCC(C)N1C(=O)C2C(Cc3ccc(O)c(O)c3)NC3(C(=O)Nc4ccc(Cl)cc43)C2C1=O |
| InChI | InChI=1S/C24H24ClN3O5/c1-3-11(2)28-21(31)19-16(8-12-4-7-17(29)18(30)9-12)27-24(20(19)22(28)32)14-10-13(25)5-6-15(14)26-23(24)33/h4-7,9-11,16,19-20,27,29-30H,3,8H2,1-2H3,(H,26,33) |
| InChIKey | RGGHTDNUGBUOLN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|