C23H22ClN3O6 — CID 29053392
(1R,3S,3aR,6aS)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 29053392) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 29053392 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (1R,3S,3aR,6aS)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(N[C@@H]2Cc2ccc(O)c(O)c2)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H22ClN3O6/c1-33-7-6-27-20(30)18-15(8-11-2-5-16(28)17(29)9-11)26-23(19(18)21(27)31)13-10-12(24)3-4-14(13)25-22(23)32/h2-5,9-10,15,18-19,26,28-29H,6-8H2,1H3,(H,25,32)/t15-,18-,19+,23-/m1/s1 |
| InChIKey | BFLLMGXTOGRSPH-JYISGYRJSA-N |
| XLogP | 1.36 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|