C28H22ClN3O7 — CID 4907950
5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4907950) has the molecular formula C28H22ClN3O7 and a molecular weight of 547.95 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4907950 |
| Molecular Formula | C28H22ClN3O7 |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-[(3,4-dihydroxyphenyl)methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1C2C(Cc3ccc(O)c(O)c3)NC3(C(=O)Nc4ccc(Cl)cc43)C2C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H22ClN3O7/c29-15-3-4-17-16(10-15)28(27(37)30-17)24-23(18(31-28)7-13-1-5-19(33)20(34)8-13)25(35)32(26(24)36)11-14-2-6-21-22(9-14)39-12-38-21/h1-6,8-10,18,23-24,31,33-34H,7,11-12H2,(H,30,37) |
| InChIKey | ZNSVCGMGGRDYOL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|