C20H24ClN3O3 — CID 7646110
(1S,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7646110) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7646110 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (1S,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC[C@H](C)N1C(=O)[C@H]2[C@@H](C1=O)[C@]1(N[C@H]2C(C)C)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H24ClN3O3/c1-5-10(4)24-17(25)14-15(18(24)26)20(23-16(14)9(2)3)12-8-11(21)6-7-13(12)22-19(20)27/h6-10,14-16,23H,5H2,1-4H3,(H,22,27)/t10-,14-,15-,16-,20-/m0/s1 |
| InChIKey | YYRKTOXXDWIDNM-JJNNYRRPSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|