C29H23FN4O3 — CID 26885073
(1R,3R,3aR,6aS)-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 26885073) has the molecular formula C29H23FN4O3 and a molecular weight of 494.53 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 26885073 |
| Molecular Formula | C29H23FN4O3 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (1R,3R,3aR,6aS)-5-(4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | Cc1cccc2c1NC(=O)[C@]21N[C@H](Cc2c[nH]c3ccccc23)[C@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C29H23FN4O3/c1-15-5-4-7-20-25(15)32-28(37)29(20)24-23(26(35)34(27(24)36)18-11-9-17(30)10-12-18)22(33-29)13-16-14-31-21-8-3-2-6-19(16)21/h2-12,14,22-24,31,33H,13H2,1H3,(H,32,37)/t22-,23-,24+,29+/m1/s1 |
| InChIKey | FTERLLSORKNUPR-CHCBTGSZSA-N |
| XLogP | 3.78 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|