C29H21Cl2FN4O3 — CID 100848176
(1R,3S,3aS,6aR)-5'-chloro-5-(3-chloro-4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 100848176) has the molecular formula C29H21Cl2FN4O3 and a molecular weight of 563.42 g/mol. Its IUPAC name is (1R,3S,3aS,6aR)-5'-chloro-5-(3-chloro-4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aS,6aR)-5'-chloro-5-(3-chloro-4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 100848176 |
| Molecular Formula | C29H21Cl2FN4O3 |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | (1R,3S,3aS,6aR)-5'-chloro-5-(3-chloro-4-fluorophenyl)-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)[C@@]21N[C@H](Cc2c[nH]c3ccccc23)[C@@H]2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C29H21Cl2FN4O3/c1-13-8-15(30)10-18-25(13)34-28(39)29(18)24-23(22(35-29)9-14-12-33-21-5-3-2-4-17(14)21)26(37)36(27(24)38)16-6-7-20(32)19(31)11-16/h2-8,10-12,22-24,33,35H,9H2,1H3,(H,34,39)/t22-,23+,24-,29-/m1/s1 |
| InChIKey | RPUKYEYTCDNLPT-CDLOMYRSSA-N |
| XLogP | 5.09 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|