C32H28N4O4 — CID 98204471
(1S,3R,3aR,6aS)-5-(4-acetylphenyl)-1-(1H-indol-3-ylmethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 98204471) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-5-(4-acetylphenyl)-1-(1H-indol-3-ylmethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-5-(4-acetylphenyl)-1-(1H-indol-3-ylmethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98204471 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (1S,3R,3aR,6aS)-5-(4-acetylphenyl)-1-(1H-indol-3-ylmethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](Cc4c[nH]c5ccccc45)N[C@]4(C(=O)Nc5c(C)cc(C)cc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C32H28N4O4/c1-16-12-17(2)28-23(13-16)32(31(40)34-28)27-26(25(35-32)14-20-15-33-24-7-5-4-6-22(20)24)29(38)36(30(27)39)21-10-8-19(9-11-21)18(3)37/h4-13,15,25-27,33,35H,14H2,1-3H3,(H,34,40)/t25-,26+,27-,32-/m0/s1 |
| InChIKey | FELRVRYUVDJZFL-XTQYNZLPSA-N |
| XLogP | 4.16 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|