C33H30N4O5 — CID 98170557
ethyl 4-[(1S,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate (PubChem CID 98170557) has the molecular formula C33H30N4O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is ethyl 4-[(1S,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate.
| Compound Name | ethyl 4-[(1S,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
|---|---|
| PubChem CID | 98170557 |
| Molecular Formula | C33H30N4O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | ethyl 4-[(1S,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](Cc4c[nH]c5ccccc45)N[C@]4(C(=O)Nc5c4ccc(C)c5C)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H30N4O5/c1-4-42-31(40)19-10-12-21(13-11-19)37-29(38)26-25(15-20-16-34-24-8-6-5-7-22(20)24)36-33(27(26)30(37)39)23-14-9-17(2)18(3)28(23)35-32(33)41/h5-14,16,25-27,34,36H,4,15H2,1-3H3,(H,35,41)/t25-,26+,27-,33-/m0/s1 |
| InChIKey | CXZLLWJRNCACGI-IZPIQJOWSA-N |
| XLogP | 4.13 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|