C30H23ClN4O5 — CID 44664487
[4-[7'-chloro-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate (PubChem CID 44664487) has the molecular formula C30H23ClN4O5 and a molecular weight of 554.99 g/mol. Its IUPAC name is [4-[7'-chloro-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate.
| Compound Name | [4-[7'-chloro-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 44664487 |
| Molecular Formula | C30H23ClN4O5 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | [4-[7'-chloro-1-(1H-indol-3-ylmethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C(Cc4c[nH]c5ccccc45)NC4(C(=O)Nc5c(Cl)cccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C30H23ClN4O5/c1-15(36)40-18-11-9-17(10-12-18)35-27(37)24-23(13-16-14-32-22-8-3-2-5-19(16)22)34-30(25(24)28(35)38)20-6-4-7-21(31)26(20)33-29(30)39/h2-12,14,23-25,32,34H,13H2,1H3,(H,33,39) |
| InChIKey | COQOVWCOLFFINH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|