C23H34N2O2 — CID 100850192
(2R)-2-(4-benzoylpiperidin-1-yl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 100850192) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (2R)-2-(4-benzoylpiperidin-1-yl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-(4-benzoylpiperidin-1-yl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 100850192 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (2R)-2-(4-benzoylpiperidin-1-yl)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H](C)N1CCC(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H34N2O2/c1-16-8-7-11-21(17(16)2)24-23(27)18(3)25-14-12-20(13-15-25)22(26)19-9-5-4-6-10-19/h4-6,9-10,16-18,20-21H,7-8,11-15H2,1-3H3,(H,24,27)/t16-,17+,18-,21+/m1/s1 |
| InChIKey | NJUFYTNHPFJELG-IIMDRIAPSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |