C19H24N4O2 — CID 100850627
[(3R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-[(2R,3S)-3-methyl-2,3-dihydro-1-benzofuran-2-yl]methanone (PubChem CID 100850627) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [(3R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-[(2R,3S)-3-methyl-2,3-dihydro-1-benzofuran-2-yl]methanone.
| Compound Name | [(3R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-[(2R,3S)-3-methyl-2,3-dihydro-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 100850627 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(3R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-[(2R,3S)-3-methyl-2,3-dihydro-1-benzofuran-2-yl]methanone |
| SMILES | Cc1nc(C)n([C@@H]2CCCN(C(=O)[C@@H]3Oc4ccccc4[C@@H]3C)C2)n1 |
| InChI | InChI=1S/C19H24N4O2/c1-12-16-8-4-5-9-17(16)25-18(12)19(24)22-10-6-7-15(11-22)23-14(3)20-13(2)21-23/h4-5,8-9,12,15,18H,6-7,10-11H2,1-3H3/t12-,15+,18+/m0/s1 |
| InChIKey | RVFINWKZZPIDIS-WBHUJUFNSA-N |
| XLogP | 2.62 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |