C15H28OSi2 — CID 10085085
(1R,3S)-5-[dimethyl(trimethylsilyl)silyl]adamantan-2-one (PubChem CID 10085085) has the molecular formula C15H28OSi2 and a molecular weight of 280.56 g/mol. Its IUPAC name is (1R,3S)-5-[dimethyl(trimethylsilyl)silyl]adamantan-2-one.
| Compound Name | (1R,3S)-5-[dimethyl(trimethylsilyl)silyl]adamantan-2-one |
|---|---|
| PubChem CID | 10085085 |
| Molecular Formula | C15H28OSi2 |
| Molecular Weight | 280.56 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,3S)-5-[dimethyl(trimethylsilyl)silyl]adamantan-2-one |
| SMILES | C[Si](C)(C)[Si](C)(C)C12CC3C[C@H](C1)C(=O)[C@@H](C3)C2 |
| InChI | InChI=1S/C15H28OSi2/c1-17(2,3)18(4,5)15-8-11-6-12(9-15)14(16)13(7-11)10-15/h11-13H,6-10H2,1-5H3/t11?,12-,13+,15? |
| InChIKey | GZWVXJBGADUOPI-WZSRBFQBSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|