About adamantan-2-one;ethane
adamantan-2-one;ethane (PubChem CID 91518879) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is adamantan-2-one;ethane.
Molecular Properties
| Compound Name | adamantan-2-one;ethane |
| PubChem CID | 91518879 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | adamantan-2-one;ethane |
| SMILES | CC.O=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H14O.C2H6/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;1-2/h6-9H,1-5H2;1-2H3 |
| InChIKey | BZGOVLYLFSAEPH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-2-one;ethane?
The IUPAC name of adamantan-2-one;ethane (CID 91518879) is adamantan-2-one;ethane.
What is the SMILES notation for adamantan-2-one;ethane?
The canonical SMILES for adamantan-2-one;ethane is CC.O=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of adamantan-2-one;ethane?
The InChIKey is BZGOVLYLFSAEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C2H6/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;1-2/h6-9H,1-5H2;1-2H3.
What are the key properties of adamantan-2-one;ethane?
adamantan-2-one;ethane has a molecular weight of 180.29 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-2-one;ethane is sourced from PubChem (CID 91518879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).