C18H28O3 — CID 10085739
(3S,3aS,7aS)-7-[2-(1,3-dioxolan-2-yl)ethyl]-7a-methyl-3-propan-2-yl-2,3,3a,4-tetrahydro-1H-inden-5-one (PubChem CID 10085739) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3S,3aS,7aS)-7-[2-(1,3-dioxolan-2-yl)ethyl]-7a-methyl-3-propan-2-yl-2,3,3a,4-tetrahydro-1H-inden-5-one.
| Compound Name | (3S,3aS,7aS)-7-[2-(1,3-dioxolan-2-yl)ethyl]-7a-methyl-3-propan-2-yl-2,3,3a,4-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 10085739 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3S,3aS,7aS)-7-[2-(1,3-dioxolan-2-yl)ethyl]-7a-methyl-3-propan-2-yl-2,3,3a,4-tetrahydro-1H-inden-5-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)C(CCC3OCCO3)=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C18H28O3/c1-12(2)15-6-7-18(3)13(10-14(19)11-16(15)18)4-5-17-20-8-9-21-17/h10,12,15-17H,4-9,11H2,1-3H3/t15-,16-,18+/m0/s1 |
| InChIKey | UOODQUBBFLQMDC-XYJFISCASA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |