C20H30O3 — CID 134840149
(3'R,3'aR)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,5,6,7,8,9,10a-octahydro-2H-benzo[f]azulene]-10'-one (PubChem CID 134840149) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3'R,3'aR)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,5,6,7,8,9,10a-octahydro-2H-benzo[f]azulene]-10'-one.
| Compound Name | (3'R,3'aR)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,5,6,7,8,9,10a-octahydro-2H-benzo[f]azulene]-10'-one |
|---|---|
| PubChem CID | 134840149 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3'R,3'aR)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,5,6,7,8,9,10a-octahydro-2H-benzo[f]azulene]-10'-one |
| SMILES | CC(C)[C@H]1CC2(OCCO2)C2C(=O)C3=C(CCCC3)CC[C@@]21C |
| InChI | InChI=1S/C20H30O3/c1-13(2)16-12-20(22-10-11-23-20)18-17(21)15-7-5-4-6-14(15)8-9-19(16,18)3/h13,16,18H,4-12H2,1-3H3/t16-,18?,19-/m1/s1 |
| InChIKey | BDPYSHXLBUTQQH-LPZUGFHBSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |