C16H20N6O3 — CID 100858045
(2R)-N-(2-nitrophenyl)-2-[(3R)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]propanamide (PubChem CID 100858045) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is (2R)-N-(2-nitrophenyl)-2-[(3R)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]propanamide.
| Compound Name | (2R)-N-(2-nitrophenyl)-2-[(3R)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100858045 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2R)-N-(2-nitrophenyl)-2-[(3R)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1[N+](=O)[O-])N1CCC[C@@H](n2cncn2)C1 |
| InChI | InChI=1S/C16H20N6O3/c1-12(16(23)19-14-6-2-3-7-15(14)22(24)25)20-8-4-5-13(9-20)21-11-17-10-18-21/h2-3,6-7,10-13H,4-5,8-9H2,1H3,(H,19,23)/t12-,13-/m1/s1 |
| InChIKey | WQFXGVRVPTUMDY-CHWSQXEVSA-N |
| XLogP | 1.85 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|