C17H24N4O4 — CID 71846089
N-(2-nitrophenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]propanamide (PubChem CID 71846089) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]propanamide.
| Compound Name | N-(2-nitrophenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 71846089 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(2-nitrophenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1[N+](=O)[O-])N1CCN(C2CCOC2)CC1 |
| InChI | InChI=1S/C17H24N4O4/c1-13(17(22)18-15-4-2-3-5-16(15)21(23)24)19-7-9-20(10-8-19)14-6-11-25-12-14/h2-5,13-14H,6-12H2,1H3,(H,18,22) |
| InChIKey | APSYJVGGXJJNED-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|