C11H9BrN4O2 — CID 10086624
3-bromo-8-ethoxy-4-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-4-ium (PubChem CID 10086624) has the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. Its IUPAC name is 3-bromo-8-ethoxy-4-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-4-ium.
| Compound Name | 3-bromo-8-ethoxy-4-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-4-ium |
|---|---|
| PubChem CID | 10086624 |
| Molecular Formula | C11H9BrN4O2 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-bromo-8-ethoxy-4-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-4-ium |
| SMILES | CCOc1ccc2n[n+]([O-])c3c(Br)cnn3c2c1 |
| InChI | InChI=1S/C11H9BrN4O2/c1-2-18-7-3-4-9-10(5-7)15-11(16(17)14-9)8(12)6-13-15/h3-6H,2H2,1H3 |
| InChIKey | YIQYJILTJJUNKQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|