C11H10N4O2 — CID 10398949
8-ethoxy-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium (PubChem CID 10398949) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 8-ethoxy-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium.
| Compound Name | 8-ethoxy-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium |
|---|---|
| PubChem CID | 10398949 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 8-ethoxy-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium |
| SMILES | CCOc1ccc2c(c1)n1nccc1n[n+]2[O-] |
| InChI | InChI=1S/C11H10N4O2/c1-2-17-8-3-4-9-10(7-8)14-11(5-6-12-14)13-15(9)16/h3-7H,2H2,1H3 |
| InChIKey | WJTPADAUNYWPAF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|