C13H20N5O3+ — CID 91016213
2-aminoethyl-(6-ethoxy-4-oxido-1-oxo-1,2,4-benzotriazin-1-ium-3-yl)-dimethylazanium (PubChem CID 91016213) has the molecular formula C13H20N5O3+ and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-aminoethyl-(6-ethoxy-4-oxido-1-oxo-1,2,4-benzotriazin-1-ium-3-yl)-dimethylazanium.
| Compound Name | 2-aminoethyl-(6-ethoxy-4-oxido-1-oxo-1,2,4-benzotriazin-1-ium-3-yl)-dimethylazanium |
|---|---|
| PubChem CID | 91016213 |
| Molecular Formula | C13H20N5O3+ |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-aminoethyl-(6-ethoxy-4-oxido-1-oxo-1,2,4-benzotriazin-1-ium-3-yl)-dimethylazanium |
| SMILES | CCOc1ccc2c(c1)n([O-])c([N+](C)(C)CCN)n[n+]2=O |
| InChI | InChI=1S/C13H20N5O3/c1-4-21-10-5-6-11-12(9-10)16(19)13(15-17(11)20)18(2,3)8-7-14/h5-6,9H,4,7-8,14H2,1-3H3/q+1 |
| InChIKey | WHOKHIIOFKODJM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|