C15H15N3O — CID 177175604
4-(5-ethoxypyrazolo[1,5-a]pyridin-3-yl)aniline (PubChem CID 177175604) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(5-ethoxypyrazolo[1,5-a]pyridin-3-yl)aniline.
| Compound Name | 4-(5-ethoxypyrazolo[1,5-a]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 177175604 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-(5-ethoxypyrazolo[1,5-a]pyridin-3-yl)aniline |
| SMILES | CCOc1ccn2ncc(-c3ccc(N)cc3)c2c1 |
| InChI | InChI=1S/C15H15N3O/c1-2-19-13-7-8-18-15(9-13)14(10-17-18)11-3-5-12(16)6-4-11/h3-10H,2,16H2,1H3 |
| InChIKey | VQXCEZBNTAYNLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|