C10H12N2O — CID 169163749
3-ethyl-5-methoxypyrazolo[1,5-a]pyridine (PubChem CID 169163749) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-ethyl-5-methoxypyrazolo[1,5-a]pyridine.
| Compound Name | 3-ethyl-5-methoxypyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 169163749 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-ethyl-5-methoxypyrazolo[1,5-a]pyridine |
| SMILES | CCc1cnn2ccc(OC)cc12 |
| InChI | InChI=1S/C10H12N2O/c1-3-8-7-11-12-5-4-9(13-2)6-10(8)12/h4-7H,3H2,1-2H3 |
| InChIKey | OAVRDYVHDXSYHT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |