C22H19N5 — CID 123655659
4-[5-[(4-isocyano-N-methylanilino)methyl]pyrazolo[1,5-a]pyridin-3-yl]aniline (PubChem CID 123655659) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-[5-[(4-isocyano-N-methylanilino)methyl]pyrazolo[1,5-a]pyridin-3-yl]aniline.
| Compound Name | 4-[5-[(4-isocyano-N-methylanilino)methyl]pyrazolo[1,5-a]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 123655659 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[5-[(4-isocyano-N-methylanilino)methyl]pyrazolo[1,5-a]pyridin-3-yl]aniline |
| SMILES | [C-]#[N+]c1ccc(N(C)Cc2ccn3ncc(-c4ccc(N)cc4)c3c2)cc1 |
| InChI | InChI=1S/C22H19N5/c1-24-19-7-9-20(10-8-19)26(2)15-16-11-12-27-22(13-16)21(14-25-27)17-3-5-18(23)6-4-17/h3-14H,15,23H2,2H3 |
| InChIKey | LMBWUVIVVYOJOW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|