About N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine
N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104732904) has the molecular formula C14H15N5
and a molecular weight of 253.31 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 104732904 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CN(Cc1ccc(N)cc1)c1nccn2nccc12 |
| InChI | InChI=1S/C14H15N5/c1-18(10-11-2-4-12(15)5-3-11)14-13-6-7-17-19(13)9-8-16-14/h2-9H,10,15H2,1H3 |
| InChIKey | NORLGKZNUFVSPA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine (CID 104732904) is N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine is CN(Cc1ccc(N)cc1)c1nccn2nccc12.
What is the InChIKey of N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is NORLGKZNUFVSPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5/c1-18(10-11-2-4-12(15)5-3-11)14-13-6-7-17-19(13)9-8-16-14/h2-9H,10,15H2,1H3.
What are the key properties of N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine?
N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 253.31 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-aminophenyl)methyl]-N-methylpyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 104732904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).