C10H14N6O — CID 104730261
N'-hydroxy-3-[methyl(pyrazolo[1,5-a]pyrazin-4-yl)amino]propanimidamide (PubChem CID 104730261) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(pyrazolo[1,5-a]pyrazin-4-yl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[methyl(pyrazolo[1,5-a]pyrazin-4-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 104730261 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N'-hydroxy-3-[methyl(pyrazolo[1,5-a]pyrazin-4-yl)amino]propanimidamide |
| SMILES | CN(CC/C(N)=N/O)c1nccn2nccc12 |
| InChI | InChI=1S/C10H14N6O/c1-15(6-3-9(11)14-17)10-8-2-4-13-16(8)7-5-12-10/h2,4-5,7,17H,3,6H2,1H3,(H2,11,14) |
| InChIKey | NMCHESGKXRQQER-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|