C9H14N4O — CID 43186264
N'-hydroxy-3-[methyl(pyridin-4-yl)amino]propanimidamide (PubChem CID 43186264) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(pyridin-4-yl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[methyl(pyridin-4-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 43186264 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N'-hydroxy-3-[methyl(pyridin-4-yl)amino]propanimidamide |
| SMILES | CN(CC/C(N)=N/O)c1ccncc1 |
| InChI | InChI=1S/C9H14N4O/c1-13(7-4-9(10)12-14)8-2-5-11-6-3-8/h2-3,5-6,14H,4,7H2,1H3,(H2,10,12) |
| InChIKey | JCNTZLPUPLLKKP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|