C9H12BrClN4O — CID 104979865
3-[(3-bromo-5-chloro-2-pyridinyl)-methylamino]-N'-hydroxypropanimidamide (PubChem CID 104979865) has the molecular formula C9H12BrClN4O and a molecular weight of 307.58 g/mol. Its IUPAC name is 3-[(3-bromo-5-chloro-2-pyridinyl)-methylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(3-bromo-5-chloro-2-pyridinyl)-methylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 104979865 |
| Molecular Formula | C9H12BrClN4O |
| Molecular Weight | 307.58 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 3-[(3-bromo-5-chloro-2-pyridinyl)-methylamino]-N'-hydroxypropanimidamide |
| SMILES | CN(CCC(N)=NO)c1ncc(Cl)cc1Br |
| InChI | InChI=1S/C9H12BrClN4O/c1-15(3-2-8(12)14-16)9-7(10)4-6(11)5-13-9/h4-5,16H,2-3H2,1H3,(H2,12,14) |
| InChIKey | ZSLIRUSOHIIHSO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|