C12H19BrClN3 — CID 114838298
N'-(3-bromo-5-chloro-2-pyridinyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 114838298) has the molecular formula C12H19BrClN3 and a molecular weight of 320.66 g/mol. Its IUPAC name is N'-(3-bromo-5-chloro-2-pyridinyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(3-bromo-5-chloro-2-pyridinyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114838298 |
| Molecular Formula | C12H19BrClN3 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N'-(3-bromo-5-chloro-2-pyridinyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)c1ncc(Cl)cc1Br |
| InChI | InChI=1S/C12H19BrClN3/c1-9(2)7-15-4-5-17(3)12-11(13)6-10(14)8-16-12/h6,8-9,15H,4-5,7H2,1-3H3 |
| InChIKey | OXSAAJUIQJUIBM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|