C22H21NO4S2 — CID 1008698
ethyl 4-(4-methoxyphenyl)-2-[(2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 1008698) has the molecular formula C22H21NO4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-2-[(2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-2-[(2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1008698 |
| Molecular Formula | C22H21NO4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-2-[(2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H21NO4S2/c1-3-27-22(25)20-18(15-9-11-16(26-2)12-10-15)13-29-21(20)23-19(24)14-28-17-7-5-4-6-8-17/h4-13H,3,14H2,1-2H3,(H,23,24) |
| InChIKey | WITBRHUYBFKPOL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|