C14H27N2O4Si+ — CID 10087018
(E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethenediazonium (PubChem CID 10087018) has the molecular formula C14H27N2O4Si+ and a molecular weight of 315.47 g/mol. Its IUPAC name is (E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethenediazonium.
| Compound Name | (E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 10087018 |
| Molecular Formula | C14H27N2O4Si+ |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethenediazonium |
| SMILES | CC1(C)O[C@H](/C(O)=C\[N+]#N)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H26N2O4Si/c1-13(2,3)21(6,7)18-9-11-12(10(17)8-16-15)20-14(4,5)19-11/h8,11-12H,9H2,1-7H3/p+1/b10-8+/t11-,12-/m1/s1 |
| InChIKey | ZEOBUYPKHCEDQL-BXAYLQTHSA-O |
| XLogP | 3.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|