C6H10Br2O3S — CID 10087452
(3R,5S)-3,5-bis(bromomethyl)-1,4-oxathiane 4,4-dioxide (PubChem CID 10087452) has the molecular formula C6H10Br2O3S and a molecular weight of 322.02 g/mol. Its IUPAC name is (3R,5S)-3,5-bis(bromomethyl)-1,4-oxathiane 4,4-dioxide.
| Compound Name | (3R,5S)-3,5-bis(bromomethyl)-1,4-oxathiane 4,4-dioxide |
|---|---|
| PubChem CID | 10087452 |
| Molecular Formula | C6H10Br2O3S |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.87 |
| IUPAC Name | (3R,5S)-3,5-bis(bromomethyl)-1,4-oxathiane 4,4-dioxide |
| SMILES | O=S1(=O)[C@H](CBr)COC[C@@H]1CBr |
| InChI | InChI=1S/C6H10Br2O3S/c7-1-5-3-11-4-6(2-8)12(5,9)10/h5-6H,1-4H2/t5-,6+ |
| InChIKey | YZIMNCBKPQCNHR-OLQVQODUSA-N |
| XLogP | 0.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|