About ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate
ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate (PubChem CID 10087621) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate.
Molecular Properties
| Compound Name | ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate |
| PubChem CID | 10087621 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate |
| SMILES | CCOC(=O)N(N=O)C1[C@@H](c2ccccc2)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-3-24-19(22)21(20-23)18-16(14-7-5-4-6-8-14)17(18)15-11-9-13(2)10-12-15/h4-12,16-18H,3H2,1-2H3/t16-,17-,18?/m0/s1 |
| InChIKey | AELUOWPMDJRYRG-UBFHEZILSA-N |
| XLogP | 4.38 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate?
The IUPAC name of ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate (CID 10087621) is ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate.
What is the SMILES notation for ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate?
The canonical SMILES for ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate is CCOC(=O)N(N=O)C1[C@@H](c2ccccc2)[C@@H]1c1ccc(C)cc1.
What is the InChIKey of ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate?
The InChIKey is AELUOWPMDJRYRG-UBFHEZILSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-3-24-19(22)21(20-23)18-16(14-7-5-4-6-8-14)17(18)15-11-9-13(2)10-12-15/h4-12,16-18H,3H2,1-2H3/t16-,17-,18?/m0/s1.
What are the key properties of ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate?
ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate has a molecular weight of 324.38 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(2R,3R)-2-(4-methylphenyl)-3-phenylcyclopropyl]-N-nitrosocarbamate is sourced from PubChem (CID 10087621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).