C22H25NO4S — CID 100887133
(1S,9R,12R)-9,10-dimethyl-12-(4-propan-2-ylphenyl)sulfonyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 100887133) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (1S,9R,12R)-9,10-dimethyl-12-(4-propan-2-ylphenyl)sulfonyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | (1S,9R,12R)-9,10-dimethyl-12-(4-propan-2-ylphenyl)sulfonyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 100887133 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (1S,9R,12R)-9,10-dimethyl-12-(4-propan-2-ylphenyl)sulfonyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | CC(C)c1ccc(S(=O)(=O)[C@H]2C(=O)N(C)[C@@]3(C)C[C@H]2c2ccccc2O3)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-14(2)15-9-11-16(12-10-15)28(25,26)20-18-13-22(3,23(4)21(20)24)27-19-8-6-5-7-17(18)19/h5-12,14,18,20H,13H2,1-4H3/t18-,20+,22+/m0/s1 |
| InChIKey | DZCZSEYXINWYBT-CZTZKLFOSA-N |
| XLogP | 3.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |