C25H29NO4S — CID 124772321
(1R,9S,10R,17R)-15-methyl-17-(4-propan-2-ylphenyl)sulfonyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one (PubChem CID 124772321) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is (1R,9S,10R,17R)-15-methyl-17-(4-propan-2-ylphenyl)sulfonyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one.
| Compound Name | (1R,9S,10R,17R)-15-methyl-17-(4-propan-2-ylphenyl)sulfonyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
|---|---|
| PubChem CID | 124772321 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (1R,9S,10R,17R)-15-methyl-17-(4-propan-2-ylphenyl)sulfonyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
| SMILES | CC(C)c1ccc(S(=O)(=O)[C@H]2C(=O)N(C)[C@@]34CCCC[C@@H]3[C@H]2c2ccccc2O4)cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-16(2)17-11-13-18(14-12-17)31(28,29)23-22-19-8-4-5-10-21(19)30-25(26(3)24(23)27)15-7-6-9-20(22)25/h4-5,8,10-14,16,20,22-23H,6-7,9,15H2,1-3H3/t20-,22-,23-,25-/m1/s1 |
| InChIKey | VDEUTSFOLNAZSZ-HBAHCVPVSA-N |
| XLogP | 4.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |