C17H19NO3 — CID 98554279
(1R,9R,10S,17S)-17-acetyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one (PubChem CID 98554279) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1R,9R,10S,17S)-17-acetyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one.
| Compound Name | (1R,9R,10S,17S)-17-acetyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
|---|---|
| PubChem CID | 98554279 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1R,9R,10S,17S)-17-acetyl-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
| SMILES | CC(=O)[C@H]1C(=O)N[C@@]23CCCC[C@H]2[C@H]1c1ccccc1O3 |
| InChI | InChI=1S/C17H19NO3/c1-10(19)14-15-11-6-2-3-8-13(11)21-17(18-16(14)20)9-5-4-7-12(15)17/h2-3,6,8,12,14-15H,4-5,7,9H2,1H3,(H,18,20)/t12-,14+,15+,17+/m0/s1 |
| InChIKey | YCNCDABLVFQUIN-DPAVQSFQSA-N |
| XLogP | 2.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|